C29H38IN3O3S — CID 18765732
N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(3,5-ditert-butyl-4-hydroxyphenoxy)acetamide;hydroiodide (PubChem CID 18765732) has the molecular formula C29H38IN3O3S and a molecular weight of 635.61 g/mol. Its IUPAC name is N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(3,5-ditert-butyl-4-hydroxyphenoxy)acetamide;hydroiodide.
| Compound Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(3,5-ditert-butyl-4-hydroxyphenoxy)acetamide;hydroiodide |
|---|---|
| PubChem CID | 18765732 |
| Molecular Formula | C29H38IN3O3S |
| Molecular Weight | 635.61 g/mol |
| Exact Mass | 635.17 |
| IUPAC Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(3,5-ditert-butyl-4-hydroxyphenoxy)acetamide;hydroiodide |
| SMILES | CC(C)(C)c1cc(OCC(=O)NCCc2ccc(/N=C(\N)c3cccs3)cc2)cc(C(C)(C)C)c1O.I |
| InChI | InChI=1S/C29H37N3O3S.HI/c1-28(2,3)22-16-21(17-23(26(22)34)29(4,5)6)35-18-25(33)31-14-13-19-9-11-20(12-10-19)32-27(30)24-8-7-15-36-24;/h7-12,15-17,34H,13-14,18H2,1-6H3,(H2,30,32)(H,31,33);1H |
| InChIKey | VCBMKGWHDKRPNH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|