C26H32ClN3O2S — CID 18765715
N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-3,5-di(propan-2-yl)benzamide;hydrochloride (PubChem CID 18765715) has the molecular formula C26H32ClN3O2S and a molecular weight of 486.08 g/mol. Its IUPAC name is N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-3,5-di(propan-2-yl)benzamide;hydrochloride.
| Compound Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-3,5-di(propan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 18765715 |
| Molecular Formula | C26H32ClN3O2S |
| Molecular Weight | 486.08 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-3,5-di(propan-2-yl)benzamide;hydrochloride |
| SMILES | CC(C)c1cc(C(=O)NCCc2ccc(/N=C(\N)c3cccs3)cc2)c(O)c(C(C)C)c1.Cl |
| InChI | InChI=1S/C26H31N3O2S.ClH/c1-16(2)19-14-21(17(3)4)24(30)22(15-19)26(31)28-12-11-18-7-9-20(10-8-18)29-25(27)23-6-5-13-32-23;/h5-10,13-17,30H,11-12H2,1-4H3,(H2,27,29)(H,28,31);1H |
| InChIKey | QUABKUSIBGNIRR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.08 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|