C24H24ClN3O3S — CID 18765827
N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2,7-dihydroxy-1H-naphthalene-2-carboxamide;hydrochloride (PubChem CID 18765827) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2,7-dihydroxy-1H-naphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2,7-dihydroxy-1H-naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18765827 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2,7-dihydroxy-1H-naphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.N/C(=N\c1ccc(CCNC(=O)C2(O)C=Cc3ccc(O)cc3C2)cc1)c1cccs1 |
| InChI | InChI=1S/C24H23N3O3S.ClH/c25-22(21-2-1-13-31-21)27-19-6-3-16(4-7-19)10-12-26-23(29)24(30)11-9-17-5-8-20(28)14-18(17)15-24;/h1-9,11,13-14,28,30H,10,12,15H2,(H2,25,27)(H,26,29);1H |
| InChIKey | DRCUWEDDQAQBLH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|