C22H23N3O3S — CID 18765735
N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-5-methoxy-3-methylbenzamide (PubChem CID 18765735) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-5-methoxy-3-methylbenzamide.
| Compound Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-5-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 18765735 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-hydroxy-5-methoxy-3-methylbenzamide |
| SMILES | COc1cc(C)c(O)c(C(=O)NCCc2ccc(/N=C(\N)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-14-12-17(28-2)13-18(20(14)26)22(27)24-10-9-15-5-7-16(8-6-15)25-21(23)19-4-3-11-29-19/h3-8,11-13,26H,9-10H2,1-2H3,(H2,23,25)(H,24,27) |
| InChIKey | LJRWIHIMGSDXHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|