C21H22ClN3S — CID 71718237
N'-[4-[2-[2-(3-chlorophenyl)ethylamino]ethyl]phenyl]thiophene-2-carboximidamide (PubChem CID 71718237) has the molecular formula C21H22ClN3S and a molecular weight of 383.95 g/mol. Its IUPAC name is N'-[4-[2-[2-(3-chlorophenyl)ethylamino]ethyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[2-[2-(3-chlorophenyl)ethylamino]ethyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 71718237 |
| Molecular Formula | C21H22ClN3S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N'-[4-[2-[2-(3-chlorophenyl)ethylamino]ethyl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(CCNCCc2cccc(Cl)c2)cc1)c1cccs1 |
| InChI | InChI=1S/C21H22ClN3S/c22-18-4-1-3-17(15-18)11-13-24-12-10-16-6-8-19(9-7-16)25-21(23)20-5-2-14-26-20/h1-9,14-15,24H,10-13H2,(H2,23,25) |
| InChIKey | ATVRASTXXITQAM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|