C29H39N3OS — CID 10390299
N'-[3-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylamino]methyl]phenyl]thiophene-2-carboximidamide (PubChem CID 10390299) has the molecular formula C29H39N3OS and a molecular weight of 477.72 g/mol. Its IUPAC name is N'-[3-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylamino]methyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylamino]methyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 10390299 |
| Molecular Formula | C29H39N3OS |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | N'-[3-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylamino]methyl]phenyl]thiophene-2-carboximidamide |
| SMILES | CC(C)(C)c1cc(CCCNCc2cccc(/N=C(\N)c3cccs3)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H39N3OS/c1-28(2,3)23-17-20(18-24(26(23)33)29(4,5)6)11-8-14-31-19-21-10-7-12-22(16-21)32-27(30)25-13-9-15-34-25/h7,9-10,12-13,15-18,31,33H,8,11,14,19H2,1-6H3,(H2,30,32) |
| InChIKey | YNXPHJZTYZMLFR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|