C40H40F2N6S — CID 145078033
N'-[3-[[2-[3-[3-[[2-(2-aminoquinolin-6-yl)ethylamino]methyl]-5-fluorophenyl]-5-fluorophenyl]ethyl-ethylamino]methyl]phenyl]thiophene-2-carboximidamide (PubChem CID 145078033) has the molecular formula C40H40F2N6S and a molecular weight of 674.87 g/mol. Its IUPAC name is N'-[3-[[2-[3-[3-[[2-(2-aminoquinolin-6-yl)ethylamino]methyl]-5-fluorophenyl]-5-fluorophenyl]ethyl-ethylamino]methyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[[2-[3-[3-[[2-(2-aminoquinolin-6-yl)ethylamino]methyl]-5-fluorophenyl]-5-fluorophenyl]ethyl-ethylamino]methyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 145078033 |
| Molecular Formula | C40H40F2N6S |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | N'-[3-[[2-[3-[3-[[2-(2-aminoquinolin-6-yl)ethylamino]methyl]-5-fluorophenyl]-5-fluorophenyl]ethyl-ethylamino]methyl]phenyl]thiophene-2-carboximidamide |
| SMILES | CCN(CCc1cc(F)cc(-c2cc(F)cc(CNCCc3ccc4nc(N)ccc4c3)c2)c1)Cc1cccc(/N=C(\N)c2cccs2)c1 |
| InChI | InChI=1S/C40H40F2N6S/c1-2-48(26-29-5-3-6-36(22-29)46-40(44)38-7-4-16-49-38)15-13-28-18-32(23-34(41)20-28)33-19-30(21-35(42)24-33)25-45-14-12-27-8-10-37-31(17-27)9-11-39(43)47-37/h3-11,16-24,45H,2,12-15,25-26H2,1H3,(H2,43,47)(H2,44,46) |
| InChIKey | XIGFPLBKMZDLRO-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|