C18H18FN3 — CID 72771077
7-[[2-(3-fluorophenyl)ethylamino]methyl]quinolin-2-amine (PubChem CID 72771077) has the molecular formula C18H18FN3 and a molecular weight of 295.36 g/mol. Its IUPAC name is 7-[[2-(3-fluorophenyl)ethylamino]methyl]quinolin-2-amine.
| Compound Name | 7-[[2-(3-fluorophenyl)ethylamino]methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 72771077 |
| Molecular Formula | C18H18FN3 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 7-[[2-(3-fluorophenyl)ethylamino]methyl]quinolin-2-amine |
| SMILES | Nc1ccc2ccc(CNCCc3cccc(F)c3)cc2n1 |
| InChI | InChI=1S/C18H18FN3/c19-16-3-1-2-13(10-16)8-9-21-12-14-4-5-15-6-7-18(20)22-17(15)11-14/h1-7,10-11,21H,8-9,12H2,(H2,20,22) |
| InChIKey | YXSBPQQVHVXHJN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|