C20H24N6 — CID 118266139
3-[2-[[2-(aminodiazenyl)quinolin-7-yl]methylamino]ethyl]-N,N-dimethylaniline (PubChem CID 118266139) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[2-[[2-(aminodiazenyl)quinolin-7-yl]methylamino]ethyl]-N,N-dimethylaniline.
| Compound Name | 3-[2-[[2-(aminodiazenyl)quinolin-7-yl]methylamino]ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 118266139 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 3-[2-[[2-(aminodiazenyl)quinolin-7-yl]methylamino]ethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(CCNCc2ccc3ccc(/N=N/N)nc3c2)c1 |
| InChI | InChI=1S/C20H24N6/c1-26(2)18-5-3-4-15(12-18)10-11-22-14-16-6-7-17-8-9-20(24-25-21)23-19(17)13-16/h3-9,12-13,22H,10-11,14H2,1-2H3,(H2,21,23,24) |
| InChIKey | QSDPFZZSVSYKQJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|