About ethane;methane;7-(4-phenylbutyl)quinolin-2-amine
ethane;methane;7-(4-phenylbutyl)quinolin-2-amine (PubChem CID 158161287) has the molecular formula C22H30N2
and a molecular weight of 322.50 g/mol. Its IUPAC name is ethane;methane;7-(4-phenylbutyl)quinolin-2-amine.
Molecular Properties
| Compound Name | ethane;methane;7-(4-phenylbutyl)quinolin-2-amine |
| PubChem CID | 158161287 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | ethane;methane;7-(4-phenylbutyl)quinolin-2-amine |
| SMILES | C.CC.Nc1ccc2ccc(CCCCc3ccccc3)cc2n1 |
| InChI | InChI=1S/C19H20N2.C2H6.CH4/c20-19-13-12-17-11-10-16(14-18(17)21-19)9-5-4-8-15-6-2-1-3-7-15;1-2;/h1-3,6-7,10-14H,4-5,8-9H2,(H2,20,21);1-2H3;1H4 |
| InChIKey | FWHNOIPARDATGX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;7-(4-phenylbutyl)quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;7-(4-phenylbutyl)quinolin-2-amine?
The IUPAC name of ethane;methane;7-(4-phenylbutyl)quinolin-2-amine (CID 158161287) is ethane;methane;7-(4-phenylbutyl)quinolin-2-amine.
What is the SMILES notation for ethane;methane;7-(4-phenylbutyl)quinolin-2-amine?
The canonical SMILES for ethane;methane;7-(4-phenylbutyl)quinolin-2-amine is C.CC.Nc1ccc2ccc(CCCCc3ccccc3)cc2n1.
What is the InChIKey of ethane;methane;7-(4-phenylbutyl)quinolin-2-amine?
The InChIKey is FWHNOIPARDATGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2.C2H6.CH4/c20-19-13-12-17-11-10-16(14-18(17)21-19)9-5-4-8-15-6-2-1-3-7-15;1-2;/h1-3,6-7,10-14H,4-5,8-9H2,(H2,20,21);1-2H3;1H4.
What are the key properties of ethane;methane;7-(4-phenylbutyl)quinolin-2-amine?
ethane;methane;7-(4-phenylbutyl)quinolin-2-amine has a molecular weight of 322.50 g/mol, XLogP of 6.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;7-(4-phenylbutyl)quinolin-2-amine is sourced from PubChem (CID 158161287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).