C19H21Cl2N3S — CID 67795805
N'-[3-(2-anilinoethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 67795805) has the molecular formula C19H21Cl2N3S and a molecular weight of 394.37 g/mol. Its IUPAC name is N'-[3-(2-anilinoethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride.
| Compound Name | N'-[3-(2-anilinoethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 67795805 |
| Molecular Formula | C19H21Cl2N3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N'-[3-(2-anilinoethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\c1cccc(CCNc2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C19H19N3S.2ClH/c20-19(18-10-5-13-23-18)22-17-9-4-6-15(14-17)11-12-21-16-7-2-1-3-8-16;;/h1-10,13-14,21H,11-12H2,(H2,20,22);2*1H |
| InChIKey | RHOMDJJRQPZETM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|