C22H24IN3S — CID 69027776
N'-[4-[2-(3-phenylprop-2-enylamino)ethyl]phenyl]thiophene-2-carboximidamide;hydroiodide (PubChem CID 69027776) has the molecular formula C22H24IN3S and a molecular weight of 489.43 g/mol. Its IUPAC name is N'-[4-[2-(3-phenylprop-2-enylamino)ethyl]phenyl]thiophene-2-carboximidamide;hydroiodide.
| Compound Name | N'-[4-[2-(3-phenylprop-2-enylamino)ethyl]phenyl]thiophene-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 69027776 |
| Molecular Formula | C22H24IN3S |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N'-[4-[2-(3-phenylprop-2-enylamino)ethyl]phenyl]thiophene-2-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\c1ccc(CCNCC=Cc2ccccc2)cc1)c1cccs1 |
| InChI | InChI=1S/C22H23N3S.HI/c23-22(21-9-5-17-26-21)25-20-12-10-19(11-13-20)14-16-24-15-4-8-18-6-2-1-3-7-18;/h1-13,17,24H,14-16H2,(H2,23,25);1H |
| InChIKey | DQZPWHGSNHMZGJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|