C28H33N3O3S — CID 139922652
N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetamide (PubChem CID 139922652) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetamide.
| Compound Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetamide |
|---|---|
| PubChem CID | 139922652 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethyl]-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CC(=O)NCCc1ccc(/N=C(\N)c3cccs3)cc1)O2 |
| InChI | InChI=1S/C28H33N3O3S/c1-17-18(2)26-22(19(3)25(17)33)11-13-28(4,34-26)16-24(32)30-14-12-20-7-9-21(10-8-20)31-27(29)23-6-5-15-35-23/h5-10,15,33H,11-14,16H2,1-4H3,(H2,29,31)(H,30,32) |
| InChIKey | QTPZILJPZAAGOE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|