C20H31ClN4O4 — CID 72948563
N-[2-[[2-(1-aminoethylideneamino)acetyl]amino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide;hydrochloride (PubChem CID 72948563) has the molecular formula C20H31ClN4O4 and a molecular weight of 426.95 g/mol. Its IUPAC name is N-[2-[[2-(1-aminoethylideneamino)acetyl]amino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[[2-(1-aminoethylideneamino)acetyl]amino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 72948563 |
| Molecular Formula | C20H31ClN4O4 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-[2-[[2-(1-aminoethylideneamino)acetyl]amino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide;hydrochloride |
| SMILES | C/C(N)=N\CC(=O)NCCNC(=O)C1(C)CCc2c(C)c(O)c(C)c(C)c2O1.Cl |
| InChI | InChI=1S/C20H30N4O4.ClH/c1-11-12(2)18-15(13(3)17(11)26)6-7-20(5,28-18)19(27)23-9-8-22-16(25)10-24-14(4)21;/h26H,6-10H2,1-5H3,(H2,21,24)(H,22,25)(H,23,27);1H |
| InChIKey | WZJKWVZVSDEVJY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|