C21H32N2O4 — CID 67262981
6-hydroxy-2,5,7,8-tetramethyl-N-(3-morpholin-4-ylpropyl)-3,4-dihydrochromene-2-carboxamide (PubChem CID 67262981) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 6-hydroxy-2,5,7,8-tetramethyl-N-(3-morpholin-4-ylpropyl)-3,4-dihydrochromene-2-carboxamide.
| Compound Name | 6-hydroxy-2,5,7,8-tetramethyl-N-(3-morpholin-4-ylpropyl)-3,4-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 67262981 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 6-hydroxy-2,5,7,8-tetramethyl-N-(3-morpholin-4-ylpropyl)-3,4-dihydrochromene-2-carboxamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)NCCCN1CCOCC1)O2 |
| InChI | InChI=1S/C21H32N2O4/c1-14-15(2)19-17(16(3)18(14)24)6-7-21(4,27-19)20(25)22-8-5-9-23-10-12-26-13-11-23/h24H,5-13H2,1-4H3,(H,22,25) |
| InChIKey | XVFQBRPTYPJBPP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|