C31H43N3O3 — CID 70385298
N-[3-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]piperazin-1-yl]propyl]-3-phenylprop-2-enamide (PubChem CID 70385298) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is N-[3-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]piperazin-1-yl]propyl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]piperazin-1-yl]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 70385298 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | N-[3-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]piperazin-1-yl]propyl]-3-phenylprop-2-enamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCN1CCN(CCCNC(=O)C=Cc3ccccc3)CC1)O2 |
| InChI | InChI=1S/C31H43N3O3/c1-23-24(2)30-27(25(3)29(23)36)13-14-31(4,37-30)15-18-34-21-19-33(20-22-34)17-8-16-32-28(35)12-11-26-9-6-5-7-10-26/h5-7,9-12,36H,8,13-22H2,1-4H3,(H,32,35) |
| InChIKey | CFSZMVBHMAEXKD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|