C32H40N4O3S — CID 22417322
2-[4-(diaminomethylideneamino)phenyl]-N-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butylsulfanyl]phenyl]acetamide (PubChem CID 22417322) has the molecular formula C32H40N4O3S and a molecular weight of 560.76 g/mol. Its IUPAC name is 2-[4-(diaminomethylideneamino)phenyl]-N-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butylsulfanyl]phenyl]acetamide.
| Compound Name | 2-[4-(diaminomethylideneamino)phenyl]-N-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22417322 |
| Molecular Formula | C32H40N4O3S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[4-(diaminomethylideneamino)phenyl]-N-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butylsulfanyl]phenyl]acetamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCSc1ccc(NC(=O)Cc3ccc(N=C(N)N)cc3)cc1)O2 |
| InChI | InChI=1S/C32H40N4O3S/c1-20-21(2)30-27(22(3)29(20)38)15-17-32(4,39-30)16-5-6-18-40-26-13-11-24(12-14-26)35-28(37)19-23-7-9-25(10-8-23)36-31(33)34/h7-14,38H,5-6,15-19H2,1-4H3,(H,35,37)(H4,33,34,36) |
| InChIKey | PMZQTCSTUVXJRZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|