C29H33ClN4O4 — CID 139805211
N-chloro-4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide (PubChem CID 139805211) has the molecular formula C29H33ClN4O4 and a molecular weight of 537.06 g/mol. Its IUPAC name is N-chloro-4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide.
| Compound Name | N-chloro-4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 139805211 |
| Molecular Formula | C29H33ClN4O4 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | N-chloro-4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOc1ccc(N(Cl)C(=O)c3ccc(N=C(N)N)cc3)cc1)O2 |
| InChI | InChI=1S/C29H33ClN4O4/c1-17-18(2)26-24(19(3)25(17)35)13-14-29(4,38-26)15-16-37-23-11-9-22(10-12-23)34(30)27(36)20-5-7-21(8-6-20)33-28(31)32/h5-12,35H,13-16H2,1-4H3,(H4,31,32,33) |
| InChIKey | GVACQHUUWLAZCY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|