C27H36N4O4 — CID 54162152
3-[4-(diaminomethylideneamino)phenyl]-N-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]ethyl]prop-2-enamide (PubChem CID 54162152) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is 3-[4-(diaminomethylideneamino)phenyl]-N-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]ethyl]prop-2-enamide.
| Compound Name | 3-[4-(diaminomethylideneamino)phenyl]-N-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54162152 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 3-[4-(diaminomethylideneamino)phenyl]-N-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]ethyl]prop-2-enamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOCCNC(=O)C=Cc1ccc(N=C(N)N)cc1)O2 |
| InChI | InChI=1S/C27H36N4O4/c1-17-18(2)25-22(19(3)24(17)33)11-12-27(4,35-25)13-15-34-16-14-30-23(32)10-7-20-5-8-21(9-6-20)31-26(28)29/h5-10,33H,11-16H2,1-4H3,(H,30,32)(H4,28,29,31) |
| InChIKey | OPEDLOHXOZLSIH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|