C27H29N3O4 — CID 67798162
2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethyl 3-[4-(diaminomethylideneamino)phenyl]prop-2-enoate (PubChem CID 67798162) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethyl 3-[4-(diaminomethylideneamino)phenyl]prop-2-enoate.
| Compound Name | 2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethyl 3-[4-(diaminomethylideneamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67798162 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethyl 3-[4-(diaminomethylideneamino)phenyl]prop-2-enoate |
| SMILES | Cc1c2c(c3ccccc3c1O)OC(C)(CCOC(=O)C=Cc1ccc(N=C(N)N)cc1)CC2 |
| InChI | InChI=1S/C27H29N3O4/c1-17-20-13-14-27(2,34-25(20)22-6-4-3-5-21(22)24(17)32)15-16-33-23(31)12-9-18-7-10-19(11-8-18)30-26(28)29/h3-12,32H,13-16H2,1-2H3,(H4,28,29,30) |
| InChIKey | BLLAUSZWOUMHTL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|