C28H42O2 — CID 171761795
2-(4,8-dimethylundecyl)-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-6-ol (PubChem CID 171761795) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2-(4,8-dimethylundecyl)-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-6-ol.
| Compound Name | 2-(4,8-dimethylundecyl)-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-6-ol |
|---|---|
| PubChem CID | 171761795 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 2-(4,8-dimethylundecyl)-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-6-ol |
| SMILES | CCCC(C)CCCC(C)CCCC1(C)CCc2c(C)c(O)c3ccccc3c2O1 |
| InChI | InChI=1S/C28H42O2/c1-6-11-20(2)12-9-13-21(3)14-10-18-28(5)19-17-23-22(4)26(29)24-15-7-8-16-25(24)27(23)30-28/h7-8,15-16,20-21,29H,6,9-14,17-19H2,1-5H3 |
| InChIKey | PRFVQNZTENZPLS-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |