C41H61NO2 — CID 10579458
5-[[ethyl(naphthalen-1-yl)amino]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 10579458) has the molecular formula C41H61NO2 and a molecular weight of 599.94 g/mol. Its IUPAC name is 5-[[ethyl(naphthalen-1-yl)amino]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 5-[[ethyl(naphthalen-1-yl)amino]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 10579458 |
| Molecular Formula | C41H61NO2 |
| Molecular Weight | 599.94 g/mol |
| Exact Mass | 599.47 |
| IUPAC Name | 5-[[ethyl(naphthalen-1-yl)amino]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | CCN(Cc1c(O)c(C)c(C)c2c1CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2)c1cccc2ccccc12 |
| InChI | InChI=1S/C41H61NO2/c1-9-42(38-24-14-22-34-21-10-11-23-35(34)38)28-37-36-25-27-41(8,44-40(36)33(7)32(6)39(37)43)26-15-20-31(5)19-13-18-30(4)17-12-16-29(2)3/h10-11,14,21-24,29-31,43H,9,12-13,15-20,25-28H2,1-8H3 |
| InChIKey | HLIOLCJPMDRDPO-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.94 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|