C37H59NO3 — CID 10578885
5-[[4-(dimethylamino)phenoxy]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 10578885) has the molecular formula C37H59NO3 and a molecular weight of 565.88 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenoxy]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 5-[[4-(dimethylamino)phenoxy]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 10578885 |
| Molecular Formula | C37H59NO3 |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 565.45 |
| IUPAC Name | 5-[[4-(dimethylamino)phenoxy]methyl]-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(COc3ccc(N(C)C)cc3)c1O)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C37H59NO3/c1-26(2)13-10-14-27(3)15-11-16-28(4)17-12-23-37(7)24-22-33-34(35(39)29(5)30(6)36(33)41-37)25-40-32-20-18-31(19-21-32)38(8)9/h18-21,26-28,39H,10-17,22-25H2,1-9H3 |
| InChIKey | PRFDJLITTVPFPY-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|