C29H49NO3 — CID 91360040
2,5,8-trimethyl-7-(nitrosomethyl)-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 91360040) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is 2,5,8-trimethyl-7-(nitrosomethyl)-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2,5,8-trimethyl-7-(nitrosomethyl)-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 91360040 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | 2,5,8-trimethyl-7-(nitrosomethyl)-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(O)c(CN=O)c(C)c2c1CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C29H49NO3/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-29(7)18-16-25-23(5)27(31)26(19-30-32)24(6)28(25)33-29/h20-22,31H,8-19H2,1-7H3 |
| InChIKey | NAAJPNHLZJSXPB-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|