C32H34N4O5 — CID 67766700
2-[4-(diaminomethylideneamino)phenoxy]-N-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]acetamide (PubChem CID 67766700) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is 2-[4-(diaminomethylideneamino)phenoxy]-N-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]acetamide.
| Compound Name | 2-[4-(diaminomethylideneamino)phenoxy]-N-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 67766700 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-[4-(diaminomethylideneamino)phenoxy]-N-[4-[2-(6-hydroxy-2,5-dimethyl-3,4-dihydrobenzo[h]chromen-2-yl)ethoxy]phenyl]acetamide |
| SMILES | Cc1c2c(c3ccccc3c1O)OC(C)(CCOc1ccc(NC(=O)COc3ccc(N=C(N)N)cc3)cc1)CC2 |
| InChI | InChI=1S/C32H34N4O5/c1-20-25-15-16-32(2,41-30(25)27-6-4-3-5-26(27)29(20)38)17-18-39-23-11-7-21(8-12-23)35-28(37)19-40-24-13-9-22(10-14-24)36-31(33)34/h3-14,38H,15-19H2,1-2H3,(H,35,37)(H4,33,34,36) |
| InChIKey | BAYDYGBUZSWKGD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|