C29H34N4O4 — CID 22417441
4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide (PubChem CID 22417441) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide.
| Compound Name | 4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 22417441 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]benzamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOc1ccc(NC(=O)c3ccc(N=C(N)N)cc3)cc1)O2 |
| InChI | InChI=1S/C29H34N4O4/c1-17-18(2)26-24(19(3)25(17)34)13-14-29(4,37-26)15-16-36-23-11-9-21(10-12-23)32-27(35)20-5-7-22(8-6-20)33-28(30)31/h5-12,34H,13-16H2,1-4H3,(H,32,35)(H4,30,31,33) |
| InChIKey | XBGVIYOTANPWFV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|