C25H33N3O5 — CID 19781155
ethyl 5-(diaminomethylideneamino)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]benzoate (PubChem CID 19781155) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is ethyl 5-(diaminomethylideneamino)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]benzoate.
| Compound Name | ethyl 5-(diaminomethylideneamino)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 19781155 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | ethyl 5-(diaminomethylideneamino)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]benzoate |
| SMILES | CCOC(=O)c1cc(N=C(N)N)ccc1OCCC1(C)CCc2c(C)c(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C25H33N3O5/c1-6-31-23(30)19-13-17(28-24(26)27)7-8-20(19)32-12-11-25(5)10-9-18-16(4)21(29)14(2)15(3)22(18)33-25/h7-8,13,29H,6,9-12H2,1-5H3,(H4,26,27,28) |
| InChIKey | OYVRWDVEVBOHOV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|