C26H30N2O5S — CID 54263268
5-[[4-[2-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methylamino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 54263268) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is 5-[[4-[2-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methylamino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methylamino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 54263268 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 5-[[4-[2-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methylamino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CNCCOc1ccc(C=C3SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C26H30N2O5S/c1-15-16(2)23-20(17(3)22(15)29)9-10-26(4,33-23)14-27-11-12-32-19-7-5-18(6-8-19)13-21-24(30)28-25(31)34-21/h5-8,13,27,29H,9-12,14H2,1-4H3,(H,28,30,31) |
| InChIKey | REZLHJHWHCIPJL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|