C28H31NO7S — CID 18658818
2-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2-methylpropanoic acid (PubChem CID 18658818) has the molecular formula C28H31NO7S and a molecular weight of 525.62 g/mol. Its IUPAC name is 2-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2-methylpropanoic acid.
| Compound Name | 2-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 18658818 |
| Molecular Formula | C28H31NO7S |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2-methylpropanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(C)(C)C(=O)O)CCC(C)(COc1ccc(/C=C3/SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C28H31NO7S/c1-15-16(2)23-20(17(3)22(15)35-27(4,5)25(31)32)11-12-28(6,36-23)14-34-19-9-7-18(8-10-19)13-21-24(30)29-26(33)37-21/h7-10,13H,11-12,14H2,1-6H3,(H,31,32)(H,29,30,33)/b21-13+ |
| InChIKey | GABJUEDTKYZPMY-FYJGNVAPSA-N |
| XLogP | 5.34 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|