C30H35NO6S — CID 72984506
5-[[3-methoxy-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 72984506) has the molecular formula C30H35NO6S and a molecular weight of 537.68 g/mol. Its IUPAC name is 5-[[3-methoxy-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-methoxy-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 72984506 |
| Molecular Formula | C30H35NO6S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 5-[[3-methoxy-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)ccc1OCC1(C)CCc2c(C)c(OCC=C(C)C)c(C)c(C)c2O1 |
| InChI | InChI=1S/C30H35NO6S/c1-17(2)11-13-35-26-18(3)19(4)27-22(20(26)5)10-12-30(6,37-27)16-36-23-9-8-21(14-24(23)34-7)15-25-28(32)31-29(33)38-25/h8-9,11,14-15H,10,12-13,16H2,1-7H3,(H,31,32,33) |
| InChIKey | ZSDPKKOYDDNPGL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|