C29H34BrNO5S — CID 91448092
5-[[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbutoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 91448092) has the molecular formula C29H34BrNO5S and a molecular weight of 588.56 g/mol. Its IUPAC name is 5-[[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbutoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbutoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 91448092 |
| Molecular Formula | C29H34BrNO5S |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 5-[[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbutoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1OCCC(C)C)CCC(C)(COc1ccc(C=C3SC(=O)NC3=O)cc1Br)O2 |
| InChI | InChI=1S/C29H34BrNO5S/c1-16(2)10-12-34-25-17(3)18(4)26-21(19(25)5)9-11-29(6,36-26)15-35-23-8-7-20(13-22(23)30)14-24-27(32)31-28(33)37-24/h7-8,13-14,16H,9-12,15H2,1-6H3,(H,31,32,33) |
| InChIKey | YXVIQVCXWXEZLQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|