C34H38N2O5S — CID 10627181
(5Z)-5-[[4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10627181) has the molecular formula C34H38N2O5S and a molecular weight of 586.75 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10627181 |
| Molecular Formula | C34H38N2O5S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | (5Z)-5-[[4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1OCc1ccccc1)CCC(C)(CN(C)CCOc1ccc(/C=C3\SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C34H38N2O5S/c1-22-23(2)31-28(24(3)30(22)40-20-26-9-7-6-8-10-26)15-16-34(4,41-31)21-36(5)17-18-39-27-13-11-25(12-14-27)19-29-32(37)35-33(38)42-29/h6-14,19H,15-18,20-21H2,1-5H3,(H,35,37,38)/b29-19- |
| InChIKey | IUCVMFQGKCHLPG-CEUNXORHSA-N |
| XLogP | 6.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|