C28H31NO5S — CID 11504165
(5Z)-5-[[3-methyl-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11504165) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is (5Z)-5-[[3-methyl-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-methyl-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11504165 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (5Z)-5-[[3-methyl-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCOc1c(C)c(C)c2c(c1C)CCC(C)(COc1ccc(/C=C3\SC(=O)NC3=O)cc1C)O2 |
| InChI | InChI=1S/C28H31NO5S/c1-7-12-32-24-17(3)18(4)25-21(19(24)5)10-11-28(6,34-25)15-33-22-9-8-20(13-16(22)2)14-23-26(30)29-27(31)35-23/h7-9,13-14H,1,10-12,15H2,2-6H3,(H,29,30,31)/b23-14- |
| InChIKey | FQGJUVGQQLATAC-UCQKPKSFSA-N |
| XLogP | 5.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|