C31H35NO8S — CID 73044315
2-[5-[[3-ethoxy-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 73044315) has the molecular formula C31H35NO8S and a molecular weight of 581.69 g/mol. Its IUPAC name is 2-[5-[[3-ethoxy-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[[3-ethoxy-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 73044315 |
| Molecular Formula | C31H35NO8S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | 2-[5-[[3-ethoxy-4-[(2,5,7,8-tetramethyl-6-prop-2-enoxy-3,4-dihydrochromen-2-yl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | C=CCOc1c(C)c(C)c2c(c1C)CCC(C)(COc1ccc(C=C3SC(=O)N(CC(=O)O)C3=O)cc1OCC)O2 |
| InChI | InChI=1S/C31H35NO8S/c1-7-13-38-27-18(3)19(4)28-22(20(27)5)11-12-31(6,40-28)17-39-23-10-9-21(14-24(23)37-8-2)15-25-29(35)32(16-26(33)34)30(36)41-25/h7,9-10,14-15H,1,8,11-13,16-17H2,2-6H3,(H,33,34) |
| InChIKey | XNWWCSIZVUCPNT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|