C23H27BrO4 — CID 45378937
3-bromo-4-[(6-ethoxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]benzaldehyde (PubChem CID 45378937) has the molecular formula C23H27BrO4 and a molecular weight of 447.37 g/mol. Its IUPAC name is 3-bromo-4-[(6-ethoxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]benzaldehyde.
| Compound Name | 3-bromo-4-[(6-ethoxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 45378937 |
| Molecular Formula | C23H27BrO4 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 3-bromo-4-[(6-ethoxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]benzaldehyde |
| SMILES | CCOc1c(C)c(C)c2c(c1C)CCC(C)(COc1ccc(C=O)cc1Br)O2 |
| InChI | InChI=1S/C23H27BrO4/c1-6-26-21-14(2)15(3)22-18(16(21)4)9-10-23(5,28-22)13-27-20-8-7-17(12-25)11-19(20)24/h7-8,11-12H,6,9-10,13H2,1-5H3 |
| InChIKey | DWULMIHDQYCZNQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|