C28H35NO5S — CID 143252098
(Z)-3-[4-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]phenyl]-2-nitrososulfanylprop-2-enal;2-methylbut-2-ene (PubChem CID 143252098) has the molecular formula C28H35NO5S and a molecular weight of 497.66 g/mol. Its IUPAC name is (Z)-3-[4-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]phenyl]-2-nitrososulfanylprop-2-enal;2-methylbut-2-ene.
| Compound Name | (Z)-3-[4-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]phenyl]-2-nitrososulfanylprop-2-enal;2-methylbut-2-ene |
|---|---|
| PubChem CID | 143252098 |
| Molecular Formula | C28H35NO5S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (Z)-3-[4-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)methoxy]phenyl]-2-nitrososulfanylprop-2-enal;2-methylbut-2-ene |
| SMILES | CC=C(C)C.Cc1c(C)c2c(c(C)c1O)CCC(C)(COc1ccc(/C=C(/C=O)SN=O)cc1)O2 |
| InChI | InChI=1S/C23H25NO5S.C5H10/c1-14-15(2)22-20(16(3)21(14)26)9-10-23(4,29-22)13-28-18-7-5-17(6-8-18)11-19(12-25)30-24-27;1-4-5(2)3/h5-8,11-12,26H,9-10,13H2,1-4H3;4H,1-3H3/b19-11-; |
| InChIKey | VZVOYVLHYYRCAN-XHFAFUTOSA-N |
| XLogP | 7.41 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|