C29H35NO5S — CID 89068393
S-[(Z)-3-oxo-1-[3-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]prop-1-en-2-yl] carbamothioate (PubChem CID 89068393) has the molecular formula C29H35NO5S and a molecular weight of 509.67 g/mol. Its IUPAC name is S-[(Z)-3-oxo-1-[3-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]prop-1-en-2-yl] carbamothioate.
| Compound Name | S-[(Z)-3-oxo-1-[3-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]prop-1-en-2-yl] carbamothioate |
|---|---|
| PubChem CID | 89068393 |
| Molecular Formula | C29H35NO5S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | S-[(Z)-3-oxo-1-[3-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]prop-1-en-2-yl] carbamothioate |
| SMILES | CC(C)=CCOc1c(C)c(C)c2c(c1C)CCC(C)(COc1cccc(/C=C(/C=O)SC(N)=O)c1)O2 |
| InChI | InChI=1S/C29H35NO5S/c1-18(2)11-13-33-26-19(3)20(4)27-25(21(26)5)10-12-29(6,35-27)17-34-23-9-7-8-22(14-23)15-24(16-31)36-28(30)32/h7-9,11,14-16H,10,12-13,17H2,1-6H3,(H2,30,32)/b24-15- |
| InChIKey | DPGZEFKAKSJWES-IWIPYMOSSA-N |
| XLogP | 6.47 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|