C38H34N4O6 — CID 139881973
[2-[[4-[bis(pyridine-3-carbonyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate (PubChem CID 139881973) has the molecular formula C38H34N4O6 and a molecular weight of 642.71 g/mol. Its IUPAC name is [2-[[4-[bis(pyridine-3-carbonyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate.
| Compound Name | [2-[[4-[bis(pyridine-3-carbonyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139881973 |
| Molecular Formula | C38H34N4O6 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | [2-[[4-[bis(pyridine-3-carbonyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)c1cccnc1)CCC(C)(COc1ccc(N(C(=O)c3cccnc3)C(=O)c3cccnc3)cc1)O2 |
| InChI | InChI=1S/C38H34N4O6/c1-24-25(2)34-32(26(3)33(24)47-37(45)29-10-7-19-41-22-29)15-16-38(4,48-34)23-46-31-13-11-30(12-14-31)42(35(43)27-8-5-17-39-20-27)36(44)28-9-6-18-40-21-28/h5-14,17-22H,15-16,23H2,1-4H3 |
| InChIKey | MRCJFBOLLIWCGF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 120.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|