C47H66N2O8 — CID 152780403
[2-(pyridine-3-carbonyloxy)-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxycarbonyloxy]pentyl] pyridine-3-carboxylate (PubChem CID 152780403) has the molecular formula C47H66N2O8 and a molecular weight of 787.05 g/mol. Its IUPAC name is [2-(pyridine-3-carbonyloxy)-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxycarbonyloxy]pentyl] pyridine-3-carboxylate.
| Compound Name | [2-(pyridine-3-carbonyloxy)-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxycarbonyloxy]pentyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 152780403 |
| Molecular Formula | C47H66N2O8 |
| Molecular Weight | 787.05 g/mol |
| Exact Mass | 786.48 |
| IUPAC Name | [2-(pyridine-3-carbonyloxy)-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxycarbonyloxy]pentyl] pyridine-3-carboxylate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)OC(C)CC(COC(=O)c1cccnc1)OC(=O)c1cccnc1)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C47H66N2O8/c1-31(2)15-10-16-32(3)17-11-18-33(4)19-12-23-47(9)24-22-41-37(8)42(35(6)36(7)43(41)57-47)56-46(52)54-34(5)27-40(55-45(51)39-21-14-26-49-29-39)30-53-44(50)38-20-13-25-48-28-38/h13-14,20-21,25-26,28-29,31-34,40H,10-12,15-19,22-24,27,30H2,1-9H3 |
| InChIKey | KTVZDLBMNMUTCC-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 123.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.05 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|