C42H66O7 — CID 19900606
(2,3-dihydroxy-2-methyl-4-phenylmethoxybutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate (PubChem CID 19900606) has the molecular formula C42H66O7 and a molecular weight of 682.98 g/mol. Its IUPAC name is (2,3-dihydroxy-2-methyl-4-phenylmethoxybutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate.
| Compound Name | (2,3-dihydroxy-2-methyl-4-phenylmethoxybutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate |
|---|---|
| PubChem CID | 19900606 |
| Molecular Formula | C42H66O7 |
| Molecular Weight | 682.98 g/mol |
| Exact Mass | 682.48 |
| IUPAC Name | (2,3-dihydroxy-2-methyl-4-phenylmethoxybutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)OCC(C)(O)C(O)COCc1ccccc1)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C42H66O7/c1-29(2)16-13-17-30(3)18-14-19-31(4)20-15-24-41(8)25-23-36-34(7)38(32(5)33(6)39(36)49-41)48-40(44)47-28-42(9,45)37(43)27-46-26-35-21-11-10-12-22-35/h10-12,21-22,29-31,37,43,45H,13-20,23-28H2,1-9H3 |
| InChIKey | IGQSUFQCCYSSJP-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.98 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|