C36H56O3 — CID 71540904
(2R)-2,5,7,8-tetramethyl-6-phenylmethoxy-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromene (PubChem CID 71540904) has the molecular formula C36H56O3 and a molecular weight of 536.84 g/mol. Its IUPAC name is (2R)-2,5,7,8-tetramethyl-6-phenylmethoxy-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromene.
| Compound Name | (2R)-2,5,7,8-tetramethyl-6-phenylmethoxy-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 71540904 |
| Molecular Formula | C36H56O3 |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.42 |
| IUPAC Name | (2R)-2,5,7,8-tetramethyl-6-phenylmethoxy-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromene |
| SMILES | Cc1c(C)c2c(c(C)c1OCc1ccccc1)CC[C@](C)(COCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C36H56O3/c1-26(2)14-12-15-27(3)16-13-17-28(4)21-23-37-25-36(8)22-20-33-31(7)34(29(5)30(6)35(33)39-36)38-24-32-18-10-9-11-19-32/h9-11,18-19,26-28H,12-17,20-25H2,1-8H3/t27?,28?,36-/m1/s1 |
| InChIKey | BPUNKQMWYHTRGX-UCLJVIDTSA-N |
| XLogP | 9.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|