C29H34O5S — CID 11225673
2-[(2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 11225673) has the molecular formula C29H34O5S and a molecular weight of 494.65 g/mol. Its IUPAC name is 2-[(2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11225673 |
| Molecular Formula | C29H34O5S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[(2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@]2(C)CCc3c(C)c(OCc4ccccc4)c(C)c(C)c3O2)cc1 |
| InChI | InChI=1S/C29H34O5S/c1-20-11-13-25(14-12-20)35(30,31)33-18-17-29(5)16-15-26-23(4)27(21(2)22(3)28(26)34-29)32-19-24-9-7-6-8-10-24/h6-14H,15-19H2,1-5H3/t29-/m0/s1 |
| InChIKey | QHZOCKCDZNOVPR-LJAQVGFWSA-N |
| XLogP | 6.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|