C38H58O4 — CID 46830102
methyl 4-[[(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxymethyl]benzoate (PubChem CID 46830102) has the molecular formula C38H58O4 and a molecular weight of 578.88 g/mol. Its IUPAC name is methyl 4-[[(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 46830102 |
| Molecular Formula | C38H58O4 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.43 |
| IUPAC Name | methyl 4-[[(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2c(C)c(C)c3c(c2C)CC[C@@](C)(CCCC(C)CCCC(C)CCCC(C)C)O3)cc1 |
| InChI | InChI=1S/C38H58O4/c1-26(2)13-10-14-27(3)15-11-16-28(4)17-12-23-38(8)24-22-34-31(7)35(29(5)30(6)36(34)42-38)41-25-32-18-20-33(21-19-32)37(39)40-9/h18-21,26-28H,10-17,22-25H2,1-9H3/t27?,28?,38-/m1/s1 |
| InChIKey | RGAVVINSIIVZAI-FCPKSKQUSA-N |
| XLogP | 10.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |