C30H38N2O3 — CID 10719321
4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]aniline (PubChem CID 10719321) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is 4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]aniline.
| Compound Name | 4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]aniline |
|---|---|
| PubChem CID | 10719321 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 4-[2-[methyl-[(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)methyl]amino]ethoxy]aniline |
| SMILES | Cc1c(C)c2c(c(C)c1OCc1ccccc1)CCC(C)(CN(C)CCOc1ccc(N)cc1)O2 |
| InChI | InChI=1S/C30H38N2O3/c1-21-22(2)29-27(23(3)28(21)34-19-24-9-7-6-8-10-24)15-16-30(4,35-29)20-32(5)17-18-33-26-13-11-25(31)12-14-26/h6-14H,15-20,31H2,1-5H3 |
| InChIKey | NMBUVUUVAMKOFD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|