C29H33NO6S — CID 139881971
[2-[[4-(benzylsulfonylamino)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 139881971) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is [2-[[4-(benzylsulfonylamino)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[[4-(benzylsulfonylamino)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 139881971 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | [2-[[4-(benzylsulfonylamino)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(COc1ccc(NS(=O)(=O)Cc3ccccc3)cc1)O2 |
| InChI | InChI=1S/C29H33NO6S/c1-19-20(2)28-26(21(3)27(19)35-22(4)31)15-16-29(5,36-28)18-34-25-13-11-24(12-14-25)30-37(32,33)17-23-9-7-6-8-10-23/h6-14,30H,15-18H2,1-5H3 |
| InChIKey | CLVLYVGWSUGDQI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|