C37H45NO7 — CID 139881931
[2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-4-oxo-3H-chromen-6-yl] acetate (PubChem CID 139881931) has the molecular formula C37H45NO7 and a molecular weight of 615.77 g/mol. Its IUPAC name is [2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-4-oxo-3H-chromen-6-yl] acetate.
| Compound Name | [2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-4-oxo-3H-chromen-6-yl] acetate |
|---|---|
| PubChem CID | 139881931 |
| Molecular Formula | C37H45NO7 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | [2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-2,5,7,8-tetramethyl-4-oxo-3H-chromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)C(=O)CC(C)(COc1ccc(NC(=O)c3c(C(C)(C)C)cc(O)cc3C(C)(C)C)cc1)O2 |
| InChI | InChI=1S/C37H45NO7/c1-20-21(2)33-30(22(3)32(20)44-23(4)39)29(41)18-37(11,45-33)19-43-26-14-12-24(13-15-26)38-34(42)31-27(35(5,6)7)16-25(40)17-28(31)36(8,9)10/h12-17,40H,18-19H2,1-11H3,(H,38,42) |
| InChIKey | CXBFBZWFAIIQPR-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|