C33H33NO8S — CID 54260265
[6-acetyloxy-2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-4-yl] benzoate (PubChem CID 54260265) has the molecular formula C33H33NO8S and a molecular weight of 603.69 g/mol. Its IUPAC name is [6-acetyloxy-2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-4-yl] benzoate.
| Compound Name | [6-acetyloxy-2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-4-yl] benzoate |
|---|---|
| PubChem CID | 54260265 |
| Molecular Formula | C33H33NO8S |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [6-acetyloxy-2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-4-yl] benzoate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)C(OC(=O)c1ccccc1)CC(C)(COc1ccc(Cc3sc(=O)[nH]c3O)cc1)O2 |
| InChI | InChI=1S/C33H33NO8S/c1-18-19(2)29-27(20(3)28(18)40-21(4)35)25(41-31(37)23-9-7-6-8-10-23)16-33(5,42-29)17-39-24-13-11-22(12-14-24)15-26-30(36)34-32(38)43-26/h6-14,25,36H,15-17H2,1-5H3,(H,34,38) |
| InChIKey | RCZVDSBFHKDUCT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|