C33H34ClNO5S — CID 54522504
[2-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]propyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 2-chlorobenzoate (PubChem CID 54522504) has the molecular formula C33H34ClNO5S and a molecular weight of 592.16 g/mol. Its IUPAC name is [2-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]propyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 2-chlorobenzoate.
| Compound Name | [2-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]propyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 54522504 |
| Molecular Formula | C33H34ClNO5S |
| Molecular Weight | 592.16 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | [2-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]propyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 2-chlorobenzoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)c1ccccc1Cl)CCC(C)(CCCc1ccc(Cc3sc(=O)[nH]c3O)cc1)O2 |
| InChI | InChI=1S/C33H34ClNO5S/c1-19-20(2)29-24(21(3)28(19)39-31(37)25-9-5-6-10-26(25)34)15-17-33(4,40-29)16-7-8-22-11-13-23(14-12-22)18-27-30(36)35-32(38)41-27/h5-6,9-14,36H,7-8,15-18H2,1-4H3,(H,35,38) |
| InChIKey | YQUUQBDCEKXJQN-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.16 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|