C36H56N2O3 — CID 139882608
[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,5-diaminobenzoate (PubChem CID 139882608) has the molecular formula C36H56N2O3 and a molecular weight of 564.86 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,5-diaminobenzoate.
| Compound Name | [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,5-diaminobenzoate |
|---|---|
| PubChem CID | 139882608 |
| Molecular Formula | C36H56N2O3 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.43 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,5-diaminobenzoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)c1cc(N)ccc1N)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C36H56N2O3/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-20-36(8)21-19-30-28(7)33(26(5)27(6)34(30)41-36)40-35(39)31-22-29(37)17-18-32(31)38/h17-18,22-25H,9-16,19-21,37-38H2,1-8H3 |
| InChIKey | RLCBHMWYEYJNIA-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|