C39H55I3O5 — CID 71715415
1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-O-(2,4,6-triiodophenyl) butanedioate (PubChem CID 71715415) has the molecular formula C39H55I3O5 and a molecular weight of 984.58 g/mol. Its IUPAC name is 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-O-(2,4,6-triiodophenyl) butanedioate.
| Compound Name | 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-O-(2,4,6-triiodophenyl) butanedioate |
|---|---|
| PubChem CID | 71715415 |
| Molecular Formula | C39H55I3O5 |
| Molecular Weight | 984.58 g/mol |
| Exact Mass | 984.12 |
| IUPAC Name | 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-O-(2,4,6-triiodophenyl) butanedioate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC(=O)Oc1c(I)cc(I)cc1I)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C39H55I3O5/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-39(8)21-19-31-29(7)36(27(5)28(6)37(31)47-39)45-34(43)17-18-35(44)46-38-32(41)22-30(40)23-33(38)42/h22-26H,9-21H2,1-8H3 |
| InChIKey | NYIDREYZSFSERW-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.58 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|